| Title: | Stitching and Analyzing Root Scans |
|---|---|
| Description: | Minirhizotrons are widely used to observe and explore roots and their growth. This package provides the means to stitch images and divide them into depth layers. Please note that this R package was developed alongside the following manuscript: Stitching root scans and extracting depth layer information -- a workflow and practical examples, S. Kersting, L. Knüver, and M. Fischer. The manuscript is currently in preparation and should be citet as soon as it is available. This project was supported by the project ArtIGROW, which is a part of the WIR!-Alliance ArtIFARM – Artificial Intelligence in Farming funded by the German Federal Ministry of Research, Technology and Space (No. 03WIR4805). |
| Authors: | Sophie Kersting [aut, cre] (ORCID: <https://orcid.org/0000-0002-1038-9246>), Linda Knüver [aut], Mareike Fischer [aut] (ORCID: <https://orcid.org/0000-0002-9429-0859>) |
| Maintainer: | Sophie Kersting <[email protected]> |
| License: | GPL (>= 3) |
| Version: | 0.0.1 |
| Built: | 2026-06-04 07:16:07 UTC |
| Source: | https://github.com/cran/RootscanR |
checkInput - This function checks a set of root scan
directories if they each contain two pictures, X.segmentation.png and
X.skeleton.png, where X is the name of the directory.
checkInput(data_dir = NULL, data_dirs = NULL)checkInput(data_dir = NULL, data_dirs = NULL)
data_dir |
(Optional, default = NULL) String specifying the name (full path) of the directory (full path) containing all root scan directories of interest. |
data_dirs |
(Optional, default = NULL) Character vector specifying all
of the individual root scan directories of interest (full paths). This is
only used if |
checkInput A list containing two TRUE-FALSE-vectors showing
if the root scan directories each contain the two root pictures.
# Replace NULL with path to directory. DATA_DIR <- NULL # Apply the function directly... cI1 <- checkInput(data_dir = DATA_DIR) # ... or use it in combination with \code{getOverviewInput}: cI2 <- checkInput(data_dirs = getOverviewInput(data_dir = DATA_DIR, naming_conv = "standard")$dir_name_full)# Replace NULL with path to directory. DATA_DIR <- NULL # Apply the function directly... cI1 <- checkInput(data_dir = DATA_DIR) # ... or use it in combination with \code{getOverviewInput}: cI2 <- checkInput(data_dirs = getOverviewInput(data_dir = DATA_DIR, naming_conv = "standard")$dir_name_full)
cm2px - Converts centimeters to pixels.
px2cm - Converts pixels to centimeters.
cm2px(cm, ppcm = NULL, ppi = NULL) px2cm(px, ppcm = NULL, ppi = NULL)cm2px(cm, ppcm = NULL, ppi = NULL) px2cm(px, ppcm = NULL, ppi = NULL)
cm |
Numeric value or numeric vector (centimeters) to be converted to pixels. |
ppcm |
Numeric value or numeric vector (default NULL) of the same length
as |
ppi |
Numeric value or numeric vector (default NULL) of the same length
as |
px |
Numeric value or numeric vector (pixels) to be converted to centimeters. |
cm2px Numeric value or numeric vector (pixels).
px2cm Numeric value or numeric vector (centimeters).
cm2px(2, 4) px2cm(2, 4)cm2px(2, 4) px2cm(2, 4)
combineStatsWithDL - This function goes through a set of image
directories and combines all existing statistics_withDepthLayers.csv-files
into one data frame, that is optionally saved as a csv.
combineStatsWithDL(data_dir, data_dirs = NULL, out_file = NA)combineStatsWithDL(data_dir, data_dirs = NULL, out_file = NA)
data_dir |
(Optional, default = NULL) String specifying the name (full path) of the directory containing all image directories of interest. |
data_dirs |
(Optional, default = NULL) Character vector specifying all
of the individual root scan directories of interest. This is only used if
|
out_file |
(Optional, default = NA) Full path of the output-csv-file.
If set to NULL, no output file is created. If its is set to NA and
|
combineStatsWithDL A data frame containing the combined
depth layer information of the images.
combineStatsWithDL(data_dir = NULL, out_file = NULL)combineStatsWithDL(data_dir = NULL, out_file = NULL)
createDepthLayerMasks - Creates a masking layer, i.e., a
true/false-matrix, indicating which pixels of an image belong to a specified
depth layer.
We assume the image was taken inside a minirhizotron, a round
plexiglas tube used to observe roots in the ground, and shows a 360 degree
scan of a section of the tube. As the minirhizotron is installed at an
angle (can be specified, by default 45 degrees) a depth layer in the ground
is shown as a sinus curve in the scan.
dissectionLine - Returns the y-value of the dissection line of a
tube that was positioned at an angle for a given position x.
The dissection line is dependent on the minpoint, the angle,
and the radius of the tube (have to be specified).
createDepthLayerMasks( ppcm = NULL, ppi = NULL, dims_px, depth_levels_cm = rbind(c(0, -10), c(-10, -20), c(-20, -30), c(-30, -40)), depth_highpoint_cm = 0, pos_highpoint_px = "center", angle = 45, top_side = "top", gap_cm = 0, gap_deg = 0 ) dissectionLine(x, minpoint, angle, radius)createDepthLayerMasks( ppcm = NULL, ppi = NULL, dims_px, depth_levels_cm = rbind(c(0, -10), c(-10, -20), c(-20, -30), c(-30, -40)), depth_highpoint_cm = 0, pos_highpoint_px = "center", angle = 45, top_side = "top", gap_cm = 0, gap_deg = 0 ) dissectionLine(x, minpoint, angle, radius)
ppcm |
Numeric value specifying how many pixels there are per
centimeter (resolution of the image). Default NULL.
If |
ppi |
Numeric value specifying how many pixels there are per inch
(resolution of the image). Default NULL.
Leave/set |
dims_px |
Integer vector of length two specifying the dimensions of the image/mask layer (in pixels). |
depth_levels_cm |
Numeric matrix with two columns and at least
one row. Each row specifies a depth interval (in cm) that is of
interest. For each interval a masking layer is generated. The first value
of each row has to be larger than the second (decending). |
depth_highpoint_cm |
Numeric value specifying the depth at which the
highest point of the image is (in cm).
By default this is at depth 0. |
pos_highpoint_px |
Either one of "center" or "edge" (default),
indicating that scanning starts at the bottom or top facing side of the
minirhizotron, respectively, or it can also be an integer value (>=1 and
<=width of the |
angle |
Numeric value >=0 and <=90 (default 45) specifying the installation angle of the minirhizotron in degrees (angle between the ground and the tube above the soil). |
top_side |
One of "left","top" (default),"right","bottom". Indicates where the upper side of the image is. |
gap_cm |
Numeric value (default 0) that specifies if there is a gap
(in cm) between the two "matching" sides of the image, i.e., there is no full
rotation of the scanner. If |
gap_deg |
Numeric value (default 0) that specifies if there is a gap
(in degrees, i.e. from 0 to 360) between the two "matching" sides
of the image, i.e., there is no full rotation of the scanner.
Works similar to |
x |
Numeric value indicating the position. |
minpoint |
Numeric vector of length 2 indicating the coordinates of the minimum point of the function. |
radius |
Positive numeric value indicating the radius of the tube. |
createDepthLayerMasks A list of 2-dimensional
true/false-matrices with the specified dimensions (see dims). True
indicates that the corresponding pixel belongs to the specified depth layer.
The list contains nrow(depth_levels_cm)-many matrices, one for each
specified depth layer.
dissectionLine
# Small example for creating a masking layer of a single depth interval: createDepthLayerMasks(ppcm = 1, dims_px = c(10,10), depth_levels_cm = matrix(c(-3,-5), ncol = 2))[[1]] # Change some parameters to adapt to a different minimum point position and # installation angle. createDepthLayerMasks(ppcm = 1, dims_px = c(5,7), depth_levels_cm = matrix(c(-1.5,-2.5), ncol = 2), pos_highpoint_px = "center", gap_cm = 0)[[1]] # And here is a cutout of that mask using a gap. createDepthLayerMasks(ppcm = 1, dims_px = c(5,5), depth_levels_cm = matrix(c(-1.5,-2.5), ncol = 2), pos_highpoint_px = "center", gap_cm = 2)[[1]] # Examples how different angles result in different dissection graphs: test_x <- -12:12 plot(test_x, sapply(X=test_x, function(X){ dissectionLine(x=X, minpoint = c(0,0), angle = 45, radius = 3)}), ylim = c(0, 20)) plot(test_x, sapply(X=test_x, function(X){ dissectionLine(x=X, minpoint = c(0,0), angle = 80, radius = 3)}), ylim = c(0, 20)) plot(test_x, sapply(X=test_x, function(X){ dissectionLine(x=X, minpoint = c(0,0), angle = 10, radius = 3)}), ylim = c(0, 20))# Small example for creating a masking layer of a single depth interval: createDepthLayerMasks(ppcm = 1, dims_px = c(10,10), depth_levels_cm = matrix(c(-3,-5), ncol = 2))[[1]] # Change some parameters to adapt to a different minimum point position and # installation angle. createDepthLayerMasks(ppcm = 1, dims_px = c(5,7), depth_levels_cm = matrix(c(-1.5,-2.5), ncol = 2), pos_highpoint_px = "center", gap_cm = 0)[[1]] # And here is a cutout of that mask using a gap. createDepthLayerMasks(ppcm = 1, dims_px = c(5,5), depth_levels_cm = matrix(c(-1.5,-2.5), ncol = 2), pos_highpoint_px = "center", gap_cm = 2)[[1]] # Examples how different angles result in different dissection graphs: test_x <- -12:12 plot(test_x, sapply(X=test_x, function(X){ dissectionLine(x=X, minpoint = c(0,0), angle = 45, radius = 3)}), ylim = c(0, 20)) plot(test_x, sapply(X=test_x, function(X){ dissectionLine(x=X, minpoint = c(0,0), angle = 80, radius = 3)}), ylim = c(0, 20)) plot(test_x, sapply(X=test_x, function(X){ dissectionLine(x=X, minpoint = c(0,0), angle = 10, radius = 3)}), ylim = c(0, 20))
findAvgOverlap - This function looks at several sets of images, which
overlap in the same way, for example the root scans (with more than one
depth window) of the same minirhizotron. It then computes the best overlap
between each pair of consecutive images (see parameters for more details on
the method) for each set of images. The best results are then found for each
image transition across all image sets depending based on the correlation
values.
findAvgOverlap( list_img_paths = NULL, list_imgs = NULL, overlap_px = NULL, max_shift_px = NULL, perc_better_per_px = 0.01, corr_formula = "1-rel_eucl_diff_colors", stitch_direction = "left_to_right" )findAvgOverlap( list_img_paths = NULL, list_imgs = NULL, overlap_px = NULL, max_shift_px = NULL, perc_better_per_px = 0.01, corr_formula = "1-rel_eucl_diff_colors", stitch_direction = "left_to_right" )
list_img_paths |
(Optional, default = NULL) List containing several
character vector specifying all of the individual image paths of interest.
Each vector must contain the same number of image paths with the
images all having the same dimensions.
This is only used if |
list_imgs |
List of lists of images (e.g., provided by the RootDetector). Each sublist must contain the same number of images with the same dimensions. Each image can be a PNG, i.e., an array with 3 dimensions (3 layers each containing a 2-dim. numeric matrix with values between 0 and 1), or a 2-dim. matrix. |
overlap_px |
Numeric vector (default NULL) specifying the (likely) widths of the overlaps between two consecutive images. The vector must have one element less than there are images and must not contain any negative values. If NULL, it is set to 1's. |
max_shift_px |
Numeric vector (default NULL) specifying the maximal
deviation in pixels from the |
perc_better_per_px |
Numeric value (percentage, default 0.01, i.e., 1
percent) specifying how much better the correlation of an overlap must be
than the |
corr_formula |
Character value specifying the formula to be used
(by default 1) for calculating how good an overlap of two images is, i.e.,
how similar the two overlapping images are. Available are the following
formulas:
|
stitch_direction |
Character specifying in which order the images should be stitched. Available are: 'left_to_right' (default), 'right_to_left', 'top_to_bottom', and 'bottom_to_top'. |
findAvgOverlap List containing the best overlaps, i.e., a
numeric vector containing the best (according to the parameters) widths of
the overlaps between the consecutive images (this vector has one element
less than there are images) as well as a list containing all possible
overlap information per image set.
# Example of finding the best overlap of two sets of two matrices. overlap <- findAvgOverlap(list_imgs = list( list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), list(matrix(c(0,0,0,0, 0,0,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 0,0,0,0, 1,1,1,0), ncol = 4, nrow = 3, byrow = TRUE))), overlap_px = 1, max_shift_px = 2, corr_formula = "weighted_matches_b_w") overlap$best_overlaps# Example of finding the best overlap of two sets of two matrices. overlap <- findAvgOverlap(list_imgs = list( list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), list(matrix(c(0,0,0,0, 0,0,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 0,0,0,0, 1,1,1,0), ncol = 4, nrow = 3, byrow = TRUE))), overlap_px = 1, max_shift_px = 2, corr_formula = "weighted_matches_b_w") overlap$best_overlaps
findAvgSurface - This function looks at several images which
should have the same surface level, for example the root scans (topmost
depth window) of the same minirhizotron. Then, the best position of the
surface level is determined by finding the best across all images.
findAvgSurface( img_paths = NULL, imgs = NULL, surface_col = "red", pos_highpoint_px = "center", radius_highpoint_px = 10, angle = 45, top_side = "left", ppcm = NULL, ppi = NULL )findAvgSurface( img_paths = NULL, imgs = NULL, surface_col = "red", pos_highpoint_px = "center", radius_highpoint_px = 10, angle = 45, top_side = "left", ppcm = NULL, ppi = NULL )
img_paths |
(Optional, default = NULL) Character vector specifying all
of the individual image paths of interest. This is only used if
|
imgs |
List of images (e.g., provided by the RootDetector). Each image can be a PNG, i.e., an array with 3 dimensions (3 layers each containing a 2-dim. numeric matrix with values between 0 and 1), or a 2-dim. matrix. |
surface_col |
Color of the area to be split of the mask (default "red"). Can be of any of the three kinds of R color specifications, i.e., either a color name (as listed by colors()), a hexadecimal string (see Details), or a positive integer (indicates using palette()). |
pos_highpoint_px |
Either one of "center" or "edge" (default),
indicating that scanning starts at the bottom or top facing side of the
minirhizotron, respectively, or it can also be an integer value (>=1 and
<=width of the |
radius_highpoint_px |
The radius specifying how large the are should be to determine the split (default 10). |
angle |
Numeric value >=0 and <=90 (default 45) specifying the installation angle of the minirhizotron in degrees (angle between the ground and the tube above the soil). |
top_side |
One of "left","top" (default),"right","bottom". Indicates where the upper side of the image is. |
ppcm |
Numeric value specifying how many pixels there are per
centimeter (resolution of the image). Default NULL.
If |
ppi |
Numeric value specifying how many pixels there are per inch
(resolution of the image). Default NULL.
Leave/set |
findAvgSurface A list with the two values
'pos_surf_px' and 'depth_highpoint_cm', and a matrix
'all_split_info' containing the information on all possible splits.
# Example of finding the best overlap of two sets of two matrices. mat_R <- matrix(c(1,1,1,1,1, 0,1,1,1,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_G <- matrix(c(0,0,0,0,1, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_G2 <- matrix(c(0,0,0,1,0, 0,0,0,0,0, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_B <- matrix(c(0,0,0,0,1, 0,0,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_B2 <- matrix(c(0,0,0,0,0, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) surface <- findAvgSurface(imgs = list( array(c(mat_R,mat_G,mat_B), dim = c(dim(mat_R),3)), array(c(mat_R,mat_G2,mat_B), dim = c(dim(mat_R),3)), array(c(mat_R,mat_G,mat_B2), dim = c(dim(mat_R),3))), radius_highpoint_px = 2, top_side = "top", ppcm = 1)# Example of finding the best overlap of two sets of two matrices. mat_R <- matrix(c(1,1,1,1,1, 0,1,1,1,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_G <- matrix(c(0,0,0,0,1, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_G2 <- matrix(c(0,0,0,1,0, 0,0,0,0,0, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_B <- matrix(c(0,0,0,0,1, 0,0,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_B2 <- matrix(c(0,0,0,0,0, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) surface <- findAvgSurface(imgs = list( array(c(mat_R,mat_G,mat_B), dim = c(dim(mat_R),3)), array(c(mat_R,mat_G2,mat_B), dim = c(dim(mat_R),3)), array(c(mat_R,mat_G,mat_B2), dim = c(dim(mat_R),3))), radius_highpoint_px = 2, top_side = "top", ppcm = 1)
findOverlap - This function searches for the best overlap between
each pair of consecutive images (see parameters for more details on the
method).
imageCorr - This function computes the similarity/correlation of two
images.
findOverlap( img_paths = NULL, imgs = NULL, overlap_px = NULL, max_shift_px = NULL, perc_better_per_px = 0.01, corr_formula = "1-rel_eucl_diff_colors", stitch_direction = "left_to_right", return_all_results = FALSE, show_messages = TRUE ) imageCorr( img_paths = NULL, imgs = NULL, corr_formula = "1-rel_eucl_diff_colors" )findOverlap( img_paths = NULL, imgs = NULL, overlap_px = NULL, max_shift_px = NULL, perc_better_per_px = 0.01, corr_formula = "1-rel_eucl_diff_colors", stitch_direction = "left_to_right", return_all_results = FALSE, show_messages = TRUE ) imageCorr( img_paths = NULL, imgs = NULL, corr_formula = "1-rel_eucl_diff_colors" )
img_paths |
(Optional, default = NULL) Character vector specifying all
of the individual image paths of interest. This is only used if
|
imgs |
List of images (e.g., provided by the RootDetector). Each image
can be a PNG, i.e., an array with 3 dimensions (3 layers each containing a
2-dim. numeric matrix with values between 0 and 1), or a 2-dim. matrix.
For |
overlap_px |
Numeric vector (default NULL) specifying the (likely) widths of the overlaps between two consecutive images. The vector must have one element less than there are images and must not contain any negative values. If NULL, it is set to 1's. |
max_shift_px |
Numeric vector (default NULL) specifying the maximal
deviation in pixels from the |
perc_better_per_px |
Numeric value (percentage, default 0.01, i.e., 1
percent) specifying how much better the correlation of an overlap must be
than the |
corr_formula |
Character value specifying the formula to be used
(by default 1) for calculating how good an overlap of two images is, i.e.,
how similar the two overlapping images are. Available are the following
formulas:
|
stitch_direction |
Character specifying in which order the images should be stitched. Available are: 'left_to_right' (default), 'right_to_left', 'top_to_bottom', and 'bottom_to_top'. |
return_all_results |
Specify if all checked overlaps with their respective correlation score should be returned (default FALSE). |
show_messages |
Specify if messages should be depicted (default TRUE). |
findOverlap Numeric vector containing the best (according
to the parameters) widths of the overlaps between the consecutive images.
The vector has one element less than there are images. Its attribute "corr"
holds the respective correlation value.
If return_all_results is set to true, a list containing a
3-column-matrix for each element in the above mentioned vector, is returned,
i.e, for each transition of two consecutive images we have the first
column containing the overlaps in pixel, the second column holding the
respective correlation values, and the third holding the threshold
correlation values accoriding to overlap_px and
perc_better_per_px.
imageCorr Numeric value (correlations score).
# Example of finding the best overlap of two matrices. overlap <- findOverlap(imgs = list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), overlap_px = 1, max_shift_px = 2, return_all_results = TRUE) # Example of computing the similarity of two images/matrices. imageCorr(imgs = list(matrix(c(1,0,0,1, 1,1,1,1, 0,1,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(1,0,0,0, 1,1,1,1, 0,1,1,1), ncol = 4, nrow = 3, byrow = TRUE)), corr_formula = "weighted_matches_colors")# Example of finding the best overlap of two matrices. overlap <- findOverlap(imgs = list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), overlap_px = 1, max_shift_px = 2, return_all_results = TRUE) # Example of computing the similarity of two images/matrices. imageCorr(imgs = list(matrix(c(1,0,0,1, 1,1,1,1, 0,1,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(1,0,0,0, 1,1,1,1, 0,1,1,1), ncol = 4, nrow = 3, byrow = TRUE)), corr_formula = "weighted_matches_colors")
findSurface - This function finds the best split of an image with a
horizontal or vertical line into one color (often red, e.g., for the
surface) and other colors (often black and white, e.g., for everything in
the ground). This works for any images. For the application on
minirhizotron root scans the function provides the additional functionality
of using the installation angle of the minirhizotron and the resolution of
the image to not only return the position of the line in pixels, but also
the corresponding depth in cm of the highest point of the top side of the
image, also called depth_highpoint_cm in other function of this
package.
splitImgHoriz - This function finds the best split of an image with a
horizontal line into one color on the top half (often red, e.g., for the
surface) and other colors on the bottom half (often black and white, e.g.,
for everything in the ground). This works for any images.
Currently, the best split is determined as the one where there are the most
equal mismatches on both sides, i.e., the same number of pixels in the top
part of the image which have not the specified color as pixels in the bottom
part of the image which have this specific color.
findSurface( img_path = NULL, img = NULL, surface_col = "red", pos_highpoint_px = "center", radius_highpoint_px = 10, angle = 45, top_side = "left", ppcm = NULL, ppi = NULL, return_all_results = FALSE ) splitImgHoriz(img, surface_col = "red", return_all_results = FALSE)findSurface( img_path = NULL, img = NULL, surface_col = "red", pos_highpoint_px = "center", radius_highpoint_px = 10, angle = 45, top_side = "left", ppcm = NULL, ppi = NULL, return_all_results = FALSE ) splitImgHoriz(img, surface_col = "red", return_all_results = FALSE)
img_path |
(Optional, default = NULL) Character vector specifying
the image path of interest. This is only used if
|
img |
Image (e.g., provided by the RootDetector) in the form of an array with 3 dimensions for the RGB color channels (3 layers each containing a 2-dim. numeric matrix with values between 0 and 1). |
surface_col |
Color of the area to be split of the mask (default "red"). Can be of any of the three kinds of R color specifications, i.e., either a color name (as listed by colors()), a hexadecimal string (see Details), or a positive integer (indicates using palette()). |
pos_highpoint_px |
Either one of "center" or "edge" (default),
indicating that scanning starts at the bottom or top facing side of the
minirhizotron, respectively, or it can also be an integer value (>=1 and
<=width of the |
radius_highpoint_px |
The radius specifying how large the are should be to determine the split (default 10). |
angle |
Numeric value >=0 and <=90 (default 45) specifying the installation angle of the minirhizotron in degrees (angle between the ground and the tube above the soil). |
top_side |
One of "left","top" (default),"right","bottom". Indicates where the upper side of the image is. |
ppcm |
Numeric value specifying how many pixels there are per
centimeter (resolution of the image). Default NULL.
If |
ppi |
Numeric value specifying how many pixels there are per inch
(resolution of the image). Default NULL.
Leave/set |
return_all_results |
Specify if all checked overlaps with their respective correlation score should be returned (default FALSE). |
findSurface A list with following features:
'pos_surf_px' and 'depth_highpoint_cm'.
If return_all_results is set to true, a list also comprises a matrix
'split_info' containing the information on all possible splits.
splitImgHoriz An integer value. The row where the upper
"surface" part of the image starts (the row included). Called 'pos_surf_px'
in the return value of the function findSurface().
If return_all_results is set to true, a list containing this best
value 'best_split' as well as a matrix 'split_info' containing the
information on all possible splits is returned instead.
# Example of finding the best row to horizontally split the image at the # highpoint position. mat_R <- matrix(c(1,1,1,1,1, 0,1,1,1,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_G <- matrix(c(0,0,0,0,1, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_B <- matrix(c(0,0,0,0,1, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) findSurface(img = array(c(mat_R,mat_G,mat_B), dim = c(dim(mat_R),3)), radius_highpoint_px = 1, top_side = "top", ppcm = 1, return_all_results = TRUE) # Example of finding the best row to horizontally split the image. # Note that the top row and one pixel in the second row is red. All others # are either black or white. mat_R <- matrix(c(1,1,1,1, 0,1,0,1, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE) mat_G <- matrix(c(0,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE) mat_B <- matrix(c(0,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE) splitImgHoriz(img = array(c(mat_R,mat_G,mat_B), dim = c(dim(mat_R),3)), return_all_results = TRUE)# Example of finding the best row to horizontally split the image at the # highpoint position. mat_R <- matrix(c(1,1,1,1,1, 0,1,1,1,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_G <- matrix(c(0,0,0,0,1, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) mat_B <- matrix(c(0,0,0,0,1, 0,1,0,0,1, 0,0,1,1,1), ncol = 5, nrow = 3, byrow = TRUE) findSurface(img = array(c(mat_R,mat_G,mat_B), dim = c(dim(mat_R),3)), radius_highpoint_px = 1, top_side = "top", ppcm = 1, return_all_results = TRUE) # Example of finding the best row to horizontally split the image. # Note that the top row and one pixel in the second row is red. All others # are either black or white. mat_R <- matrix(c(1,1,1,1, 0,1,0,1, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE) mat_G <- matrix(c(0,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE) mat_B <- matrix(c(0,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE) splitImgHoriz(img = array(c(mat_R,mat_G,mat_B), dim = c(dim(mat_R),3)), return_all_results = TRUE)
getDepthLayerInfo - Specify a set of root scan directories in the
form of a data frame (e.g., by using getOverviewInput()). Then, the
function will do the following:
If there are several depth windows of the same root scan (project, tube,
date and session have to be identical), then these will be stitched and
saved in directory of the scan of depth window 1.
Create depth layer masks corresponding to the specified
depth_levels_cm.
Computes a range of values from the scans (per depth layer: "pixels_root",
"pixels_bg", "skel_pixels_total", "skel_pixels_low3", "skel_pixels_3-7",
"skel_pixels_larg7","kimura_length6") and if (save_csvs = TRUE) saves
them as a csv file in the directory of the scan of depth window 1.
Returns a data frame containing values listed above of all scans.
getDepthLayerInfo( root_df = NULL, depth_levels_cm = rbind(c(0, -10), c(-10, -20), c(-20, -30), c(-30, -40)), overwrite = FALSE, save_csvs = TRUE, save_pngs_col = "grey" )getDepthLayerInfo( root_df = NULL, depth_levels_cm = rbind(c(0, -10), c(-10, -20), c(-20, -30), c(-30, -40)), overwrite = FALSE, save_csvs = TRUE, save_pngs_col = "grey" )
root_df |
Data frame (default = NULL) specifying the structure
of the root scan data. It can be created using the function
|
depth_levels_cm |
Numeric matrix with two columns and at least
one row. Each row specifies a depth interval (in cm) that is of
interest. For each interval a masking layer is generated. The first value
of each row has to be larger than the second (decending). |
overwrite |
If FALSE (default), root scan directories are skipped that have already been processed by a particular procedure, i.e., there already are stitched images before beginning the stitching procedure, there already are images with depth layers drawn in before saving thme or there already is a statistics_withDepthLayers.csv file when it comes to evaluating the image. If TRUE, all procedures are applied to the scan and corresponding files are overwritten. |
save_csvs |
Specifies if csv files for the individual scans should be saved in the scan's directory (default TRUE). |
save_pngs_col |
If not NULL, the root scans with depth layers drawn in
are saved in the scan's directory. Specifies the color of the FALSE-regions
of the mask (default "grey"). Can be a vector of the same length as
the number of depth intervals to allow each layer to be drawn in with a
different color. |
getDepthLayerInfo A data frame containing the depth layer
information of all individual scans.
getDepthLayerInfo()getDepthLayerInfo()
getDepthLayerInfo_par - Specify a set of root scan directories in the
form of a data frame (e.g., by using getOverviewInput()). Then, the
function will do the following:
If there are several depth windows of the same root scan (project, tube,
date and session have to be identical), then these will be stitched and
saved in directory of the scan of depth window 1.
Create depth layer masks corresponding to the specified
depth_levels_cm.
Computes a range of values from the scans (per depth layer: "pixels_root",
"pixels_bg", "skel_pixels_total", "skel_pixels_low3", "skel_pixels_3-7",
"skel_pixels_larg7","kimura_length6") and if (save_csvs = TRUE) saves
them as a csv file in the directory of the scan of depth window 1.
Returns a data frame containing values listed above of all scans.
getDepthLayerInfo_par( root_df = NULL, depth_levels_cm = rbind(c(0, -10), c(-10, -20), c(-20, -30), c(-30, -40)), overwrite = FALSE, save_csvs = TRUE, save_pngs_col = "grey", core_number = 1L )getDepthLayerInfo_par( root_df = NULL, depth_levels_cm = rbind(c(0, -10), c(-10, -20), c(-20, -30), c(-30, -40)), overwrite = FALSE, save_csvs = TRUE, save_pngs_col = "grey", core_number = 1L )
root_df |
Data frame (default = NULL) specifying the structure
of the root scan data. It can be created using the function
|
depth_levels_cm |
Numeric matrix with two columns and at least
one row. Each row specifies a depth interval (in cm) that is of
interest. For each interval a masking layer is generated. The first value
of each row has to be larger than the second (decending). |
overwrite |
If FALSE (default), root scan directories are skipped that have already been processed by a particular procedure, i.e., there already are stitched images before beginning the stitching procedure, there already are images with depth layers drawn in before saving thme or there already is a statistics_withDepthLayers.csv file when it comes to evaluating the image. If TRUE, all procedures are applied to the scan and corresponding files are overwritten. |
save_csvs |
Specifies if csv files for the individual scans should be saved in the scan's directory (default TRUE). |
save_pngs_col |
If not NULL, the root scans with depth layers drawn in
are saved in the scan's directory. Specifies the color of the FALSE-regions
of the mask (default "grey"). Can be a vector of the same length as
the number of depth intervals to allow each layer to be drawn in with a
different color. |
core_number |
Integer value specifying the bumber of cores (default = 1) used in parallelized procedures. |
getDepthLayerInfo_par A data frame containing the depth layer
information of all individual scans.
getDepthLayerInfo_par()getDepthLayerInfo_par()
getNeighborCoords - Returns coordinates of all pixels in a two
dimensional raster/image/... with a specified Euclidean distance from the
center, i.e., a pixel circle, either a ring or the whole area with a
specified radius.
getNeighborCoords( center, radius, dims_px = c(1000, 1000), type = "ring", tol = "strict", tol_val = 0.5 )getNeighborCoords( center, radius, dims_px = c(1000, 1000), type = "ring", tol = "strict", tol_val = 0.5 )
center |
Numeric vector of length two specifying the coordinates (in pixels) of the center point. |
radius |
Integer value specifying the radius (in pixels). A radius of 0 returns only the center point itself. |
dims_px |
Numeric vector of length two (default: 1,000 x 1,000) specifying the dimensions (in pixels). Neighbors outside are ignored. |
type |
Character, "ring" (default) or "area", specifying if the pixel coordinates of only the outer ring or of the whole circle area should be returned. |
tol |
Character, "strict" (default) or "loose", specifying how thick
the ring/outer edge of the area should be, i.e., if pixels
close but not exactly on the circle should be included. If set to "loose",
all pixels that touch the circle are included. If set to "strict", only
additional pixels whose centers have a distance of at most |
tol_val |
Numeric value specifying the tolerance value (>=0,<1,
default: 0.5), i.e., pixels are considered neighbors if the difference
between their Euclidean distance to the center and the radius is less than
or equal to the tolerance value.
Only applies if |
getNeighborCoords Numeric matrix with two columns containing
the neighbors' coordinates (in pixels).
# The neighbors with radius 1 of point (4,4) in an 8x8 grid. # With tolerance 0.5: test <- matrix(0, nrow = 8, ncol = 8) test[getNeighborCoords(c(4,4), 1, c(8,8))] <- 1 test # With tolerance 0.4: test <- matrix(0, nrow = 8, ncol = 8) test[getNeighborCoords(c(4,4), 1, c(8,8), tol_val = 0.4)] <- 1 test# The neighbors with radius 1 of point (4,4) in an 8x8 grid. # With tolerance 0.5: test <- matrix(0, nrow = 8, ncol = 8) test[getNeighborCoords(c(4,4), 1, c(8,8))] <- 1 test # With tolerance 0.4: test <- matrix(0, nrow = 8, ncol = 8) test[getNeighborCoords(c(4,4), 1, c(8,8), tol_val = 0.4)] <- 1 test
getOverviewInput - This function filters a set of root scan
directories by checking if they comply with the given naming convention and
then returns overview data about these directories.
getOverviewInput(data_dir, data_dirs = NULL, naming_conv = "standard")getOverviewInput(data_dir, data_dirs = NULL, naming_conv = "standard")
data_dir |
(Optional, default = NULL) String specifying the name (full path) of the directory containing all root scan directories of interest. |
data_dirs |
(Optional, default = NULL) Character vector specifying all
of the individual root scan directories of interest. This is only used if
|
naming_conv |
A string specifying the naming convention, i.e., what
information is provided within the names of the root scans. The file format
can be png, tiff, jpg, or jpeg (upper or lowercase).
Available are:
|
getOverviewInput A data frame containing the information
about the various root scan directories (see also
getDepthLvlInfo() for further explanations).
getOverviewInput(data_dir = NULL, naming_conv = "standard")getOverviewInput(data_dir = NULL, naming_conv = "standard")
kimuraLength - Computes the Kimura length according to
the specified formula to estimate the root length
shown in a skeletonized black & white image of a root.
Optionally, a masking layer can be specified that indicates which pixels of
the image should be considered.
kimuraLength( skel_img, formula = 6, mask = NULL, strict_mask = TRUE, show_messages = TRUE )kimuraLength( skel_img, formula = 6, mask = NULL, strict_mask = TRUE, show_messages = TRUE )
skel_img |
Skeleton image (provided by the RootDetector). Can be a PNG, i.e., an array with 3 dimensions (3 layers each containing a 2-dim. numeric matrix with values between 0 and 1), or a 2-dim. matrix. |
formula |
Integer value specifying the formula to be used (by default
6) based on Kimura et al., 1999 (see references). Available are the
following formulas, where
|
mask |
2-dim. true/false-matrix with the same number of rows and columns
as |
strict_mask |
Specifies how strictly the mask should be applied.
Available are:
|
show_messages |
Specify if messages about the counts of orthogonal and diagonal connection counts should be depicted (default TRUE). |
kimuraLength Numeric value (root length estimation).
Kimura, K., Kikuchi, S. & Yamasaki, Si. Accurate root length measurement by image analysis. Plant and Soil 216, 117–127 (1999). doi: 10.1023/A:1004778925316
# This is a simple image with 2 diagonal and 1 orthogonal connections. # With Formula 6 (default): kimuraLength(matrix(c( 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1 ), ncol = 4, nrow = 3, byrow = TRUE)) # With Formula 4: kimuraLength( matrix(c( 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1 ), ncol = 4, nrow = 3, byrow = TRUE), formula = 4 ) # With Formula 6 and a mask which makes the function ignore the right side # of the image. If stict_mask = TRUE, only 1 diagonal connection can be # found. If set to FALSE, i.e., relaxed mask borders, then 2 diagonal # connections are counted. kimuraLength( skel_img = matrix(c( 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1 ), ncol = 4, nrow = 3, byrow = TRUE), mask = matrix( c( TRUE, TRUE, FALSE, FALSE, TRUE, TRUE, FALSE, FALSE, TRUE, TRUE, FALSE, FALSE ), ncol = 4, nrow = 3, byrow = TRUE ), strict_mask = FALSE )# This is a simple image with 2 diagonal and 1 orthogonal connections. # With Formula 6 (default): kimuraLength(matrix(c( 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1 ), ncol = 4, nrow = 3, byrow = TRUE)) # With Formula 4: kimuraLength( matrix(c( 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1 ), ncol = 4, nrow = 3, byrow = TRUE), formula = 4 ) # With Formula 6 and a mask which makes the function ignore the right side # of the image. If stict_mask = TRUE, only 1 diagonal connection can be # found. If set to FALSE, i.e., relaxed mask borders, then 2 diagonal # connections are counted. kimuraLength( skel_img = matrix(c( 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1 ), ncol = 4, nrow = 3, byrow = TRUE), mask = matrix( c( TRUE, TRUE, FALSE, FALSE, TRUE, TRUE, FALSE, FALSE, TRUE, TRUE, FALSE, FALSE ), ncol = 4, nrow = 3, byrow = TRUE ), strict_mask = FALSE )
ppcm2ppi - Converts a resolution given in pixels per cm to pixels
per inch.
ppi2ppcm - Converts a resolution given in pixels per inch to pixels
per cm.
ppcm2ppi(ppcm) ppi2ppcm(ppi)ppcm2ppi(ppcm) ppi2ppcm(ppi)
ppcm |
Numeric value or numeric vector of resolutions in ppcm to be converted to ppi. |
ppi |
Numeric value or numeric vector of resolutions in ppi to be converted to ppcm. |
ppcm2ppi Numeric value or numeric vector of resolutions in
ppi.
ppi2ppcm Numeric value or numeric vector of resolutions in
ppcm.
ppcm2ppi(2) ppi2ppcm(2)ppcm2ppi(2) ppi2ppcm(2)
showImgMask - Depicts an image, e.g., a root scan, with an optional
masking layer using a specified color.
applyImgMask - Changes the colouring of an image, e.g., a root scan,
according to a masking layer using a specified color. If only a matrix is
provided, it is treated like the r-layer (referring to the rgb color values).
showImgMask(root_img = NULL, mask = NULL, mask_col = "grey") applyImgMask(root_img = NULL, mask = NULL, mask_col = "grey")showImgMask(root_img = NULL, mask = NULL, mask_col = "grey") applyImgMask(root_img = NULL, mask = NULL, mask_col = "grey")
root_img |
Root image. Can be a PNG, i.e., an array with 3 dimensions (3 layers each containing a 2-dim. numeric matrix with values between 0 and 1), or a 2-dim. matrix. If the root image is NULL (default), then a completely black image is used. |
mask |
2-dim. true/false-matrix with the same number of rows and columns
as |
mask_col |
Color of the FALSE-regions of the mask (default "grey"). Can be of any of the three kinds of R color specifications, i.e., either a color name (as listed by colors()), a hexadecimal string (see Details), or a positive integer (indicates using palette()). |
showImgMask No return value, called for side effects
(plotting).
applyImgMask An array with 3 dimensions
(3 layers each containing a 2-dim. numeric matrix with values between
0 and 1) like a PNG.
# Basic example: showImgMask(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(TRUE, FALSE,FALSE,TRUE, TRUE, TRUE, TRUE, TRUE, FALSE,TRUE, TRUE, FALSE), ncol = 4, nrow = 3, byrow = TRUE)) # Example using the createDepthLayerMasks()-function:. showImgMask(root_img = matrix(c(1,0,0,0,0,0,0, 0,1,0,0,0,0,0, 0,0,1,1,0,0,0), ncol = 7, nrow = 3, byrow = TRUE), mask = createDepthLayerMasks(ppcm = 1, dims_px = c(3,7), depth_levels_cm = rbind(c(-1,-2), c(-2,-3)))[[1]], mask_col ="brown") # Basic example: applyImgMask(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(TRUE, FALSE,FALSE,TRUE, TRUE, TRUE, TRUE, TRUE, FALSE,TRUE, TRUE, FALSE), ncol = 4, nrow = 3, byrow = TRUE))# Basic example: showImgMask(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(TRUE, FALSE,FALSE,TRUE, TRUE, TRUE, TRUE, TRUE, FALSE,TRUE, TRUE, FALSE), ncol = 4, nrow = 3, byrow = TRUE)) # Example using the createDepthLayerMasks()-function:. showImgMask(root_img = matrix(c(1,0,0,0,0,0,0, 0,1,0,0,0,0,0, 0,0,1,1,0,0,0), ncol = 7, nrow = 3, byrow = TRUE), mask = createDepthLayerMasks(ppcm = 1, dims_px = c(3,7), depth_levels_cm = rbind(c(-1,-2), c(-2,-3)))[[1]], mask_col ="brown") # Basic example: applyImgMask(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(TRUE, FALSE,FALSE,TRUE, TRUE, TRUE, TRUE, TRUE, FALSE,TRUE, TRUE, FALSE), ncol = 4, nrow = 3, byrow = TRUE))
skelPxWidth - Counts the skeleton pixels that belong to root pieces
of certain (circular) widths (diameter <3px, 3-7px, >7px).
For each white root pixel in the skeleton image, it checks how large (in
terms of the categories <3px, 3-7px, >7px, which equal a radius of <1px,
1-3px, >=4px) the circle of white root pixels is that surrounds it in the
base root image.
Optionally, a masking layer can be specified that indicates which pixels of
the skeleton image should be checked (the radius of the white circle is
still check in the complete base image).
skelPxWidth(base_img, skel_img, mask = NULL)skelPxWidth(base_img, skel_img, mask = NULL)
base_img |
Base image (provided by the RootDetector). Can be a PNG, i.e., an array with 3 dimensions (3 layers each containing a 2-dim. numeric matrix with values between 0 and 1), or a 2-dim. matrix. |
skel_img |
Skeleton image with the same number of rows and columns
as |
mask |
2-dim. true/false-matrix with the same number of rows and columns
as |
skelPxWidth Numeric vector of length 3 containing the counts.
# In this example there are 2 white root pixels in the skeleton image. # The left one is completely surrounded by white pixels in the base image, # it falls into Category 2 (3-7px). The bottom right one has a black # neighboring pixel and thus falls in to Category 1 (<3px). Thus, the result # is Categorie 1: 1 pixel, Cat. 2: 1 pixel, Cat. 3: 0 pixels. skelPxWidth(base_img = matrix(c(1,1,1,0, 1,1,1,0, 1,1,1,1), ncol = 4, nrow = 3, byrow = TRUE), skel_img = matrix(c(0,0,0,0, 0,1,0,0, 0,0,0,1), ncol = 4, nrow = 3, byrow = TRUE)) # Similar example with a mask which makes the function "ignore" the right # side of the skeleton image. # The function still identifies the left white pixel as of Category 2. skelPxWidth(matrix(c(1,1,1,0, 1,1,1,0, 1,1,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 0,1,0,0, 0,0,0,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(TRUE,TRUE,FALSE,FALSE, TRUE,TRUE,FALSE,FALSE, TRUE,TRUE,FALSE,FALSE), ncol = 4, nrow = 3, byrow = TRUE))# In this example there are 2 white root pixels in the skeleton image. # The left one is completely surrounded by white pixels in the base image, # it falls into Category 2 (3-7px). The bottom right one has a black # neighboring pixel and thus falls in to Category 1 (<3px). Thus, the result # is Categorie 1: 1 pixel, Cat. 2: 1 pixel, Cat. 3: 0 pixels. skelPxWidth(base_img = matrix(c(1,1,1,0, 1,1,1,0, 1,1,1,1), ncol = 4, nrow = 3, byrow = TRUE), skel_img = matrix(c(0,0,0,0, 0,1,0,0, 0,0,0,1), ncol = 4, nrow = 3, byrow = TRUE)) # Similar example with a mask which makes the function "ignore" the right # side of the skeleton image. # The function still identifies the left white pixel as of Category 2. skelPxWidth(matrix(c(1,1,1,0, 1,1,1,0, 1,1,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 0,1,0,0, 0,0,0,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(TRUE,TRUE,FALSE,FALSE, TRUE,TRUE,FALSE,FALSE, TRUE,TRUE,FALSE,FALSE), ncol = 4, nrow = 3, byrow = TRUE))
stitchImgs - This function stitches all specified images (currently
only PNGs supported) together in a line.
It also searches for the best overlap between two consecutive
images (see parameters and findOverlap()).
If overlap_px is already known, this
function calls blendImgs().
blendImgs - This function stitches all specified images
together in a line according to specified overlap widths.
stitchImgs( img_paths = NULL, imgs = NULL, out_file = NULL, overlap_px = NULL, max_shift_px = NULL, perc_better_per_px = 0.01, corr_formula = "1-rel_eucl_diff_colors", stitch_direction = "left_to_right", blending_mode = "under", show_messages = TRUE ) blendImgs( img_paths = NULL, imgs = NULL, out_file = NULL, overlap_px, stitch_direction = "left_to_right", blending_mode = "under" )stitchImgs( img_paths = NULL, imgs = NULL, out_file = NULL, overlap_px = NULL, max_shift_px = NULL, perc_better_per_px = 0.01, corr_formula = "1-rel_eucl_diff_colors", stitch_direction = "left_to_right", blending_mode = "under", show_messages = TRUE ) blendImgs( img_paths = NULL, imgs = NULL, out_file = NULL, overlap_px, stitch_direction = "left_to_right", blending_mode = "under" )
img_paths |
(Optional, default = NULL) Character vector specifying all
of the individual image paths of interest. This is only used if
|
imgs |
List of images (e.g., provided by the RootDetector). Each image
can be a PNG, i.e., an array with 3 dimensions (3 layers each containing a
2-dim. numeric matrix with values between 0 and 1), or a 2-dim. matrix.
For |
out_file |
Full path for how the stitched image should be saved, e.g. 'C:/path/stitched.png'. If no path is provided, the image is not saved (only returned). |
overlap_px |
Numeric vector (default NULL) specifying the (likely) widths of the overlaps between two consecutive images. The vector must have one element less than there are images and must not contain any negative values. |
max_shift_px |
Numeric vector (default NULL) specifying the maximal
deviation in pixels from the |
perc_better_per_px |
Numeric value (percentage, default 0.01, i.e., 1
percent) specifying how much better the correlation of an overlap must be
than the |
corr_formula |
Character value specifying the formula to be used
(by default 1) for calculating how good an overlap of two images is, i.e.,
how similar the two overlapping images are. Available are the following
formulas:
|
stitch_direction |
Character specifying in which order the images should be stitched. Available are: 'left_to_right' (default), 'right_to_left', 'top_to_bottom', and 'bottom_to_top'. |
blending_mode |
Character value specifying how overlapping pixels are
combined. Available are:
|
show_messages |
Specify if messages should be depicted (default TRUE). |
stitchImgs The stitched image in the form of a PNG, i.e.,
an array with 3 dimensions (3 layers each containing a 2-dim. numeric matrix
with values between 0 and 1).
blendImgs The stitched image in the form of a
PNG, i.e., an array with 3 dimensions (3 layers each containing a 2-dim.
numeric matrix with values between 0 and 1).
# Small example of stitching two 3x4 matrices left to right together. test <- stitchImgs(imgs = list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), overlap_px = 1, max_shift_px = 2) # The stitched image also contains the overlaps used for stitching. attributes(test) # Example of stitching the two matrices with a fixed (in this case not # optimal) overlap. blendImgs(imgs = list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), overlap_px = 1, blending_mode = "over")[,,1]# Small example of stitching two 3x4 matrices left to right together. test <- stitchImgs(imgs = list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), overlap_px = 1, max_shift_px = 2) # The stitched image also contains the overlaps used for stitching. attributes(test) # Example of stitching the two matrices with a fixed (in this case not # optimal) overlap. blendImgs(imgs = list(matrix(c(1,0,0,0, 0,1,0,0, 0,0,1,1), ncol = 4, nrow = 3, byrow = TRUE), matrix(c(0,0,0,0, 1,0,0,1, 0,1,1,0), ncol = 4, nrow = 3, byrow = TRUE)), overlap_px = 1, blending_mode = "over")[,,1]